ChemNet > CAS > 7355-58-0 N-(2-Chloroethyl)acetamide
7355-58-0 N-(2-Chloroethyl)acetamide
| product Name |
N-(2-Chloroethyl)acetamide |
| CAS No |
7355-58-0 |
| Synonyms |
Acetamide, N-(2-chloroethyl)-; 4-04-00-00449 (Beilstein Handbook Reference); AI3-08685; BRN 1743108; NSC 30247 |
| Molecular Formula |
C4H8ClNO |
| Molecular Weight |
121.5654 |
| InChI |
InChI=1/C4H8ClNO/c1-4(7)6-3-2-5/h2-3H2,1H3,(H,6,7) |
| EINECS |
230-884-5 |
| Molecular Structure |
|
| Density |
1.086g/cm3 |
| Boiling point |
275.6°C at 760 mmHg |
| Refractive index |
1.432 |
| Flash point |
120.4°C |
| Vapour Pressur |
0.00506mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R33:Danger of cummulative effects.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
