ChemNet > CAS > 73746-44-8 4,5-diiodo-2-methyl-1H-imidazole
73746-44-8 4,5-diiodo-2-methyl-1H-imidazole
| product Name |
4,5-diiodo-2-methyl-1H-imidazole |
| CAS No |
73746-44-8 |
| Synonyms |
4,5-Diiodo-2-methylimidazole |
| Molecular Formula |
C4H4I2N2 |
| Molecular Weight |
333.8969 |
| InChI |
InChI=1/C4H4I2N2/c1-2-7-3(5)4(6)8-2/h1H3,(H,7,8) |
| Molecular Structure |
|
| Density |
2.75g/cm3 |
| Melting point |
194℃ |
| Boiling point |
434.9°C at 760 mmHg |
| Refractive index |
1.749 |
| Flash point |
216.8°C |
| Vapour Pressur |
2.33E-07mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
