ChemNet > CAS > 7391-28-8 4-Methylbenzoylacetonitrile
7391-28-8 4-Methylbenzoylacetonitrile
| product Name |
4-Methylbenzoylacetonitrile |
| CAS No |
7391-28-8 |
| Synonyms |
p-Toluoylacetonitrile; 3-oxo-3-p-tolylpropanenitrile; 3-(4-methylphenyl)-3-oxopropanenitrile |
| Molecular Formula |
C10H9NO |
| Molecular Weight |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-8-2-4-9(5-3-8)10(12)6-7-11/h2-5H,6H2,1H3 |
| Molecular Structure |
|
| Density |
1.081g/cm3 |
| Melting point |
100-102℃ |
| Boiling point |
318.2°C at 760 mmHg |
| Refractive index |
1.532 |
| Flash point |
146.2°C |
| Vapour Pressur |
0.000367mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
