ChemNet > CAS > 73960-07-3 4-(Difluoromethoxy)benzaldehyde
73960-07-3 4-(Difluoromethoxy)benzaldehyde
| product Name |
4-(Difluoromethoxy)benzaldehyde |
| CAS No |
73960-07-3 |
| Synonyms |
p-(Difluoromethoxy)benzaldehyde |
| Molecular Formula |
C8H6F2O2 |
| Molecular Weight |
172.1288 |
| InChI |
InChI=1/C8H6F2O2/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-5,8H |
| EINECS |
277-653-5 |
| Molecular Structure |
|
| Density |
1.262g/cm3 |
| Boiling point |
234.7°C at 760 mmHg |
| Refractive index |
1.497 |
| Flash point |
93.1°C |
| Vapour Pressur |
0.0522mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
