ChemNet > CAS > 74003-55-7 3,4-Dibromobenzaldehyde
74003-55-7 3,4-Dibromobenzaldehyde
| product Name |
3,4-Dibromobenzaldehyde |
| CAS No |
74003-55-7 |
| Synonyms |
3,4-Dibromo-benzaldehyde |
| Molecular Formula |
C7H4Br2O |
| Molecular Weight |
263.9141 |
| InChI |
InChI=1/C7H4Br2O/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
| Molecular Structure |
|
| Density |
1.977g/cm3 |
| Boiling point |
303.6°C at 760 mmHg |
| Refractive index |
1.645 |
| Flash point |
123°C |
| Vapour Pressur |
0.00092mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
