ChemNet > CAS > 74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
| product Name |
1,3-Thiazolin-4-one-2-acetonitrile |
| CAS No |
74246-64-3 |
| Synonyms |
2-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile; (4-oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile |
| Molecular Formula |
C5H4N2OS |
| Molecular Weight |
140.1631 |
| InChI |
InChI=1/C5H4N2OS/c6-2-1-5-7-4(8)3-9-5/h1,3H2 |
| Molecular Structure |
|
| Density |
1.43g/cm3 |
| Melting point |
185℃ |
| Boiling point |
300.6°C at 760 mmHg |
| Refractive index |
1.675 |
| Flash point |
135.6°C |
| Vapour Pressur |
0.00111mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
