ChemNet > CAS > 7429-37-0 trans-1,2-Dibromocyclohexane
7429-37-0 trans-1,2-Dibromocyclohexane
| product Name |
trans-1,2-Dibromocyclohexane |
| CAS No |
7429-37-0 |
| Synonyms |
Dibromocyclohexane; (1S,2S)-1,2-dibromocyclohexane |
| Molecular Formula |
C6H10Br2 |
| Molecular Weight |
241.9516 |
| InChI |
InChI=1/C6H10Br2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6-/m0/s1 |
| EINECS |
231-070-2 |
| Molecular Structure |
|
| Density |
1.79g/cm3 |
| Boiling point |
220.548°C at 760 mmHg |
| Refractive index |
1.553 |
| Flash point |
91.462°C |
| Vapour Pressur |
0.166mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
