ChemNet > CAS > 7459-46-3 Triethyl 1,1,2-ethanetricarboxylate
7459-46-3 Triethyl 1,1,2-ethanetricarboxylate
| product Name |
Triethyl 1,1,2-ethanetricarboxylate |
| CAS No |
7459-46-3 |
| Synonyms |
1,1,2-Ethanetricarboxylic acid triethyl ester; Triethyl ethane-1,1,2-tricarboxylate; 1,1,2-Ethanetricarboxylic acid, 1,1,2-triethyl ester;
|
| Molecular Formula |
C11H18O6 |
| Molecular Weight |
246.257 |
| InChI |
InChI=1/C11H18O6/c1-4-15-9(12)7-8(10(13)16-5-2)11(14)17-6-3/h8H,4-7H2,1-3H3 |
| EINECS |
231-235-9 |
| Molecular Structure |
|
| Density |
1.114g/cm3 |
| Boiling point |
300.7°C at 760 mmHg |
| Refractive index |
1.44 |
| Flash point |
127.4°C |
| Vapour Pressur |
0.0011mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
