ChemNet > CAS > 7472-43-7 6-Benzoylhexanoic acid
7472-43-7 6-Benzoylhexanoic acid
| product Name |
6-Benzoylhexanoic acid |
| CAS No |
7472-43-7 |
| Synonyms |
7-Oxo-7-phenylheptanoic acid; 7-Oxo-7-phenyl-heptanoic acid; 6-Benzoyl hexanoic Acid |
| Molecular Formula |
C13H16O3 |
| Molecular Weight |
220.2643 |
| InChI |
InChI=1/C13H16O3/c14-12(11-7-3-1-4-8-11)9-5-2-6-10-13(15)16/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,16) |
| Molecular Structure |
|
| Density |
1.111g/cm3 |
| Boiling point |
396°C at 760 mmHg |
| Refractive index |
1.528 |
| Flash point |
207.4°C |
| Vapour Pressur |
5.57E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
