ChemNet > CAS > 74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
| product Name |
3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid |
| CAS No |
74772-17-1 |
| Molecular Formula |
C9H7NO2S |
| Molecular Weight |
193.2224 |
| InChI |
InChI=1/C9H7NO2S/c11-9(12)8-7(3-6-13-8)10-4-1-2-5-10/h1-6H,(H,11,12) |
| Molecular Structure |
|
| Density |
1.37g/cm3 |
| Melting point |
174℃ |
| Boiling point |
377.3°C at 760 mmHg |
| Refractive index |
1.669 |
| Flash point |
182°C |
| Vapour Pressur |
2.31E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
