ChemNet > CAS > 7499-07-2 4-Chloro-2-methylbenzoic acid
7499-07-2 4-Chloro-2-methylbenzoic acid
| product Name |
4-Chloro-2-methylbenzoic acid |
| Molecular Formula |
C8H7ClO2 |
| Molecular Weight |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| CAS Registry Number |
7499-07-2 |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Melting point |
180℃ |
| Boiling point |
300.3°C at 760 mmHg |
| Refractive index |
1.573 |
| Flash point |
135.4°C |
| Vapour Pressur |
0.000504mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
4-Chloro-2-methylbenzoic acid Material Safety Data Sheet
|
|
