ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
| product Name |
Bromodichloromethane |
| CAS No |
75-27-4 |
| Synonyms |
FC-20B1 |
| Molecular Formula |
CHBrCl2 |
| Molecular Weight |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| EINECS |
200-856-7 |
| Molecular Structure |
|
| Density |
2.013g/cm3 |
| Melting point |
-55℃ |
| Boiling point |
89.7°C at 760 mmHg |
| Refractive index |
1.503 |
| Flash point |
1.3°C |
| Vapour Pressur |
65.3mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
