ChemNet > CAS > 75-39-8 Acetaldehyde ammonia trimer
75-39-8 Acetaldehyde ammonia trimer
| product Name |
Acetaldehyde ammonia trimer |
| CAS No |
75-39-8 |
| Synonyms |
Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| Molecular Formula |
C2H7NO |
| Molecular Weight |
61.0831 |
| InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| EINECS |
200-868-2 |
| Molecular Structure |
|
| Density |
0.967g/cm3 |
| Melting point |
95-97℃ |
| Boiling point |
113.8°C at 760 mmHg |
| Refractive index |
1.431 |
| Flash point |
22.7°C |
| Vapour Pressur |
10.4mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
