ChemNet > CAS > 75129-74-7 4-Nitrophenoxyacetic acid hydrazide
75129-74-7 4-Nitrophenoxyacetic acid hydrazide
| product Name |
4-Nitrophenoxyacetic acid hydrazide |
| CAS No |
75129-74-7 |
| Synonyms |
Acetic acid, (4-nitrophenoxy)-, hydrazide; 2-(4-nitrophenoxy)acetohydrazide |
| Molecular Formula |
C8H9N3O4 |
| Molecular Weight |
211.1748 |
| InChI |
InChI=1/C8H9N3O4/c9-10-8(12)5-15-7-3-1-6(2-4-7)11(13)14/h1-4H,5,9H2,(H,10,12) |
| Molecular Structure |
|
| Density |
1.394g/cm3 |
| Boiling point |
511.9°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
263.4°C |
| Vapour Pressur |
1.35E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
