ChemNet > CAS > 7541-49-3 Phytol
7541-49-3 Phytol
| product Name |
Phytol |
| CAS No |
7541-49-3 |
| Synonyms |
2-hexadecen-1-ol, 3,7,11,15-tetramethyl-; 3,7,11,15-Tetramethylhexadec-2-en-1-ol |
| Molecular Formula |
C20H40O |
| Molecular Weight |
296.531 |
| InChI |
InChI=1/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3 |
| Molecular Structure |
|
| Density |
0.845g/cm3 |
| Boiling point |
335.5°C at 760 mmHg |
| Refractive index |
1.459 |
| Flash point |
157.5°C |
| Vapour Pressur |
8.32E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
