ChemNet > CAS > 75507-68-5 Flupirtine Maleate
75507-68-5 Flupirtine Maleate
| product Name |
Flupirtine Maleate |
| CAS No |
75507-68-5 |
| Synonyms |
ethyl 2-amino-6-[(4-fluorobenzyl)amino]pyridine-3-carbamate, compound with maleic acid (1:1); Ethyl 2-amino-6-[(4-fluorobenzyl)amino]pyridine-3-carbamate compound with maleic acid (1:1); ethyl {2-amino-6-[(4-fluorobenzyl)amino]pyridin-3-yl}carbamate (2Z)-but-2-enedioate |
| Molecular Formula |
C19H21FN4O6 |
| Molecular Weight |
420.3916 |
| InChI |
InChI=1/C15H17FN4O2.C4H4O4/c1-2-22-15(21)19-12-7-8-13(20-14(12)17)18-9-10-3-5-11(16)6-4-10;5-3(6)1-2-4(7)8/h3-8H,2,9H2,1H3,(H,19,21)(H3,17,18,20);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| EINECS |
278-225-0 |
| Molecular Structure |
|
| Boiling point |
434.9°C at 760 mmHg |
| Flash point |
216.8°C |
| Vapour Pressur |
9.1E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
