ChemNet > CAS > 7560-44-3 Methyl 4-chlorocinnamate
7560-44-3 Methyl 4-chlorocinnamate
| product Name |
Methyl 4-chlorocinnamate |
| CAS No |
7560-44-3 |
| Synonyms |
4-Chlorocinnamic acid methyl ester; methyl 3-(4-chlorophenyl)prop-2-enoate; methyl (2E)-3-(4-chlorophenyl)prop-2-enoate |
| Molecular Formula |
C10H9ClO2 |
| Molecular Weight |
196.6303 |
| InChI |
InChI=1/C10H9ClO2/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7H,1H3/b7-4+ |
| EINECS |
231-451-3 |
| Molecular Structure |
|
| Density |
1.211g/cm3 |
| Melting point |
76-77℃ |
| Boiling point |
292.8°C at 760 mmHg |
| Refractive index |
1.572 |
| Flash point |
144.4°C |
| Vapour Pressur |
0.0018mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
