ChemNet > CAS > 75705-21-4 4-Aminomethylphenylboronic acid hydrochloride
75705-21-4 4-Aminomethylphenylboronic acid hydrochloride
| product Name |
4-Aminomethylphenylboronic acid hydrochloride |
| CAS No |
75705-21-4 |
| Synonyms |
[4-(aminomethyl)phenyl]boronic acid |
| Molecular Formula |
C7H10BNO2 |
| Molecular Weight |
150.9708 |
| InChI |
InChI=1/C7H10BNO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5,9H2 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Boiling point |
337.7°C at 760 mmHg |
| Refractive index |
1.567 |
| Flash point |
158.1°C |
| Vapour Pressur |
4.02E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
