ChemNet > CAS > 758-16-7 N,N-Dimethylthioformamide
758-16-7 N,N-Dimethylthioformamide
| product Name |
N,N-Dimethylthioformamide |
| CAS No |
758-16-7 |
| Synonyms |
NN-Dimethylthioformamide |
| Molecular Formula |
C3H7NS |
| Molecular Weight |
89.1594 |
| InChI |
InChI=1/C3H7NS/c1-4(2)3-5/h3H,1-2H3 |
| EINECS |
212-060-7 |
| Molecular Structure |
|
| Density |
0.985g/cm3 |
| Boiling point |
224.9°C at 760 mmHg |
| Refractive index |
1.511 |
| Flash point |
89.8°C |
| Vapour Pressur |
0.089mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
| MSDS |
Material Safety Data Sheet
|
|
