ChemNet > CAS > 7581-97-7 2,3-Dichlorobutane
7581-97-7 2,3-Dichlorobutane
| product Name |
2,3-Dichlorobutane |
| CAS No |
7581-97-7 |
| Synonyms |
2,3-Dichlorobutane,mixture of dl and meso; 2,3-Dichlorobutane- dl + meso; (2S,3S)-2,3-dichlorobutane |
| Molecular Formula |
C4H8Cl2 |
| Molecular Weight |
127.0123 |
| InChI |
InChI=1/C4H8Cl2/c1-3(5)4(2)6/h3-4H,1-2H3/t3-,4-/m0/s1 |
| EINECS |
231-486-4 |
| Molecular Structure |
|
| Density |
1.076g/cm3 |
| Melting point |
-80℃ |
| Boiling point |
110.467°C at 760 mmHg |
| Refractive index |
1.425 |
| Flash point |
18.333°C |
| Vapour Pressur |
27.87mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
|
| Risk Codes |
R11:Highly flammable.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
|
| MSDS |
Material Safety Data Sheet
|
|
