ChemNet > CAS > 7598-91-6 Ethyl 5-hydroxy-2-methylindole-3-carboxylate
7598-91-6 Ethyl 5-hydroxy-2-methylindole-3-carboxylate
| product Name |
Ethyl 5-hydroxy-2-methylindole-3-carboxylate |
| CAS No |
7598-91-6 |
| Synonyms |
5-Hydroxy-2-methyl-3-indolecarboxylic acid ethyl ester; ethyl 5-hydroxy-2-methyl-1H-indole-3-carboxylate |
| Molecular Formula |
C12H13NO3 |
| Molecular Weight |
219.2365 |
| InChI |
InChI=1/C12H13NO3/c1-3-16-12(15)11-7(2)13-10-5-4-8(14)6-9(10)11/h4-6,13-14H,3H2,1-2H3 |
| EINECS |
231-507-7 |
| Molecular Structure |
|
| Density |
1.282g/cm3 |
| Melting point |
206-210℃ |
| Boiling point |
406.7°C at 760 mmHg |
| Refractive index |
1.64 |
| Flash point |
199.7°C |
| Vapour Pressur |
3.4E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
