ChemNet > CAS > 765-87-7 1,2-Cyclohexanedione
765-87-7 1,2-Cyclohexanedione
| product Name |
1,2-Cyclohexanedione |
| CAS No |
765-87-7 |
| Synonyms |
1,2-Dioxocyclohexane; 4-07-00-01982 (Beilstein Handbook Reference); AI3-25042; BRN 0507419; CCRIS 6296; NSC 32950; cyclohexane-1,2-dione |
| Molecular Formula |
C12H18O3 |
| Molecular Weight |
210.2695 |
| InChI |
InChI=1/C12H18O3/c1-3-7-11-9(5-1)13-12(15-11)8-4-2-6-10(12)14-11/h9-10H,1-8H2 |
| EINECS |
212-155-3 |
| Molecular Structure |
|
| Melting point |
35-38℃ |
| Refractive index |
1.546 |
| Water solubility |
soluble |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
