ChemNet > CAS > 7663-77-6 N-(3'-Aminopropyl)-2-pyrrolidinone
7663-77-6 N-(3'-Aminopropyl)-2-pyrrolidinone
| product Name |
N-(3'-Aminopropyl)-2-pyrrolidinone |
| CAS No |
7663-77-6 |
| Molecular Formula |
C7H15N2O |
| Molecular Weight |
143.2063 |
| InChI |
InChI=1/C7H14N2O/c8-4-2-6-9-5-1-3-7(9)10/h1-6,8H2/p+1 |
| EINECS |
231-632-7 |
| Molecular Structure |
|
| Boiling point |
312°C at 760 mmHg |
| Flash point |
132.4°C |
| Vapour Pressur |
0.000545mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
