ChemNet > CAS > 76649-14-4 3-Octen-2-ol
76649-14-4 3-Octen-2-ol
| product Name |
3-Octen-2-ol |
| CAS No |
76649-14-4 |
| Synonyms |
FEMA No. 3602; oct-3-en-2-ol; (3E)-oct-3-en-2-ol |
| Molecular Formula |
C8H16O |
| Molecular Weight |
128.212 |
| InChI |
InChI=1/C8H16O/c1-3-4-5-6-7-8(2)9/h6-9H,3-5H2,1-2H3/b7-6+ |
| EINECS |
278-508-9 |
| Molecular Structure |
|
| Density |
0.843g/cm3 |
| Boiling point |
178.8°C at 760 mmHg |
| Refractive index |
1.447 |
| Flash point |
63.4°C |
| Vapour Pressur |
0.291mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
