ChemNet > CAS > 7697-29-2 4-Chloro-3-methylbenzoic acid
7697-29-2 4-Chloro-3-methylbenzoic acid
| product Name |
4-Chloro-3-methylbenzoic acid |
| CAS No |
7697-29-2 |
| Synonyms |
3-Methyl -4-Chlorobenzoic acid; 3-methyl-4-chlorobenzoic acid; 4-CHLORO-M-TOLUIC ACID; 4-Chloro-3-toluic acid; 4-Chloro-3-Methyl |
| Molecular Formula |
C8H7ClO2 |
| Molecular Weight |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11) |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Boiling point |
299°C at 760 mmHg |
| Refractive index |
1.573 |
| Flash point |
134.6°C |
| Vapour Pressur |
0.000548mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
