ChemNet > CAS > 76989-89-4 Cyanourea, sodium salt
76989-89-4 Cyanourea, sodium salt
| product Name |
Cyanourea, sodium salt |
| CAS No |
76989-89-4 |
| Synonyms |
Cyanourea sodium salt; Cyanoisourea sodium salt; 1-cyanourea; sodium N'-cyanoimidocarbamate |
| Molecular Formula |
C2H2N3NaO |
| Molecular Weight |
107.0465 |
| InChI |
InChI=1/C2H3N3O.Na/c3-1-5-2(4)6;/h(H3,4,5,6);/q;+1/p-1 |
| EINECS |
278-584-3 |
| Molecular Structure |
|
| Melting point |
300℃ |
| Boiling point |
263.3°C at 760 mmHg |
| Flash point |
113.1°C |
| Vapour Pressur |
0.00146mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
