ChemNet > CAS > 77159-76-3 4-Bromo-2,6-dimethylphenyl isocyanate
77159-76-3 4-Bromo-2,6-dimethylphenyl isocyanate
| product Name |
4-Bromo-2,6-dimethylphenyl isocyanate |
| CAS No |
77159-76-3 |
| Synonyms |
5-bromo-2-isocyanato-1,3-dimethylbenzene |
| Molecular Formula |
C9H8BrNO |
| Molecular Weight |
226.0699 |
| InChI |
InChI=1/C9H8BrNO/c1-6-3-8(10)4-7(2)9(6)11-5-12/h3-4H,1-2H3 |
| Molecular Structure |
|
| Density |
1.39g/cm3 |
| Boiling point |
280.5°C at 760 mmHg |
| Refractive index |
1.563 |
| Flash point |
123.5°C |
| Vapour Pressur |
0.00376mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Safety Description |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
