ChemNet > CAS > 7731-29-5 trans-4-Methylcyclohexanol
7731-29-5 trans-4-Methylcyclohexanol
| product Name |
trans-4-Methylcyclohexanol |
| CAS No |
7731-29-5 |
| Molecular Formula |
C7H14O |
| Molecular Weight |
114.18 |
| InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
| EINECS |
231-790-7 |
| Molecular Structure |
|
| Density |
0.91 |
| Boiling point |
173-175℃ |
| Refractive index |
1.454-1.456 |
| Flash point |
70℃ |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
