ChemNet > CAS > 77337-82-7 2-Bromo-5-nitroanisole
77337-82-7 2-Bromo-5-nitroanisole
| product Name |
2-Bromo-5-nitroanisole |
| CAS No |
77337-82-7 |
| Synonyms |
4-Bromo-3-methoxynitrobenzene; 1-bromo-2-methoxy-4-nitrobenzene |
| Molecular Formula |
C7H6BrNO3 |
| Molecular Weight |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-7-4-5(9(10)11)2-3-6(7)8/h2-4H,1H3 |
| EINECS |
278-669-5 |
| Molecular Structure |
|
| Density |
1.64g/cm3 |
| Melting point |
103℃ |
| Boiling point |
302.1°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
136.5°C |
| Vapour Pressur |
0.00181mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
