ChemNet > CAS > 774-07-2 Ethyl 4-amino-2-mercaptopyrimidine-5-carboxylate
774-07-2 Ethyl 4-amino-2-mercaptopyrimidine-5-carboxylate
| product Name |
Ethyl 4-amino-2-mercaptopyrimidine-5-carboxylate |
| CAS No |
774-07-2 |
| Synonyms |
4-Amino-2-mercaptopyrimidine-5-carboxylic acid ethyl ester; ethyl 6-amino-2-thioxo-1,2-dihydropyrimidine-5-carboxylate |
| Molecular Formula |
C7H9N3O2S |
| Molecular Weight |
199.2303 |
| InChI |
InChI=1/C7H9N3O2S/c1-2-12-6(11)4-3-9-7(13)10-5(4)8/h3H,2H2,1H3,(H3,8,9,10,13) |
| Molecular Structure |
|
| Density |
1.48g/cm3 |
| Melting point |
261℃ |
| Boiling point |
329.7°C at 760 mmHg |
| Refractive index |
1.659 |
| Flash point |
153.2°C |
| Vapour Pressur |
0.000174mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
