ChemNet > CAS > 776-35-2 9,10-Dihydrophenanthrene
776-35-2 9,10-Dihydrophenanthrene
| product Name |
9,10-Dihydrophenanthrene |
| CAS No |
776-35-2 |
| Synonyms |
Dihydrophenanthrene; 9,10-DIHYDROPHENANTHRENE 96+% |
| Molecular Formula |
C14H12 |
| Molecular Weight |
180.2451 |
| InChI |
InChI=1/C14H12/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-8H,9-10H2 |
| EINECS |
212-278-2 |
| Molecular Structure |
|
| Density |
1.085g/cm3 |
| Melting point |
32-35℃ |
| Boiling point |
307.8°C at 760 mmHg |
| Refractive index |
1.62 |
| Flash point |
144.1°C |
| Vapour Pressur |
0.00129mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
