CAS No: 7778-06-5, Chemical Name: N,N,1,3-tetramethyl-1,3,2-diazaphospholidin-2-amine 2-oxide
the physical and chemical property of 7778-06-5, N,N,1,3-tetramethyl-1,3,2-diazaphospholidin-2-amine 2-oxide is provided by ChemNet.com
ChemNet > CAS > 7778-06-5 N,N,1,3-tetramethyl-1,3,2-diazaphospholidin-2-amine 2-oxide
7778-06-5 N,N,1,3-tetramethyl-1,3,2-diazaphospholidin-2-amine 2-oxide
| product Name |
N,N,1,3-tetramethyl-1,3,2-diazaphospholidin-2-amine 2-oxide |
| Synonyms |
|
| Molecular Formula |
C6H16N3OP |
| Molecular Weight |
177.1845 |
| InChI |
InChI=1/C6H16N3OP/c1-7(2)11(10)8(3)5-6-9(11)4/h5-6H2,1-4H3 |
| CAS Registry Number |
7778-06-5 |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Boiling point |
252.6°C at 760 mmHg |
| Refractive index |
1.506 |
| Flash point |
106.6°C |
| Vapour Pressur |
0.0191mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
