ChemNet > CAS > 779-02-2 9-Methylanthracene
779-02-2 9-Methylanthracene
| product Name |
9-Methylanthracene |
| CAS No |
779-02-2 |
| Synonyms |
Methylantracene; anthracene,9-methyl- |
| Molecular Formula |
C15H12 |
| Molecular Weight |
192.26 |
| InChI |
InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
| EINECS |
212-299-7 |
| Molecular Structure |
|
| Density |
1.06 |
| Melting point |
77-80℃ |
| Boiling point |
196-197℃(12 torr) |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
