ChemNet > CAS > 78-19-3 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane
78-19-3 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane
product Name |
3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
Synonyms |
3,9-Divinylspirobis(m-dioxan); 3,9-diethenyl-2,4,8,10-tetraoxaspiro[5.5]undecane; 3,9-Divinylspirobi(m-dioxane); 3,9-Divinyl-2,4,8,10-tetraoxaspiro(5.5)undecane |
Molecular Formula |
C11H16O4 |
Molecular Weight |
212.2423 |
InChI |
InChI=1/C11H16O4/c1-3-9-12-5-11(6-13-9)7-14-10(4-2)15-8-11/h3-4,9-10H,1-2,5-8H2 |
CAS Registry Number |
78-19-3 |
EINECS |
201-092-7 |
Molecular Structure |
|
Density |
1.11g/cm3 |
Melting point |
43-46℃ |
Boiling point |
284.4°C at 760 mmHg |
Refractive index |
1.493 |
Flash point |
106.6°C |
Vapour Pressur |
0.00512mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|