ChemNet > CAS > 78301-72-1 4-phenyl-1,2,3-thiadiazol-5-amine
78301-72-1 4-phenyl-1,2,3-thiadiazol-5-amine
| product Name |
4-phenyl-1,2,3-thiadiazol-5-amine |
| CAS No |
78301-72-1 |
| Molecular Formula |
C8H7N3S |
| Molecular Weight |
177.2263 |
| InChI |
InChI=1/C8H7N3S/c9-8-7(10-11-12-8)6-4-2-1-3-5-6/h1-5H,9H2 |
| Molecular Structure |
|
| Density |
1.333g/cm3 |
| Melting point |
146℃ |
| Boiling point |
341.4°C at 760 mmHg |
| Refractive index |
1.669 |
| Flash point |
160.3°C |
| Vapour Pressur |
8.05E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
