ChemNet > CAS > 78667-04-6 2-(chloromethyl)-1-methyl-1H-imidazole hydrochloride
78667-04-6 2-(chloromethyl)-1-methyl-1H-imidazole hydrochloride
| product Name |
2-(chloromethyl)-1-methyl-1H-imidazole hydrochloride |
| CAS No |
78667-04-6 |
| Molecular Formula |
C5H8Cl2N2 |
| Molecular Weight |
167.0364 |
| InChI |
InChI=1/C5H7ClN2.ClH/c1-8-3-2-7-5(8)4-6;/h2-3H,4H2,1H3;1H |
| Molecular Structure |
|
| Melting point |
150℃ |
| Boiling point |
243.7°C at 760 mmHg |
| Flash point |
101.2°C |
| Vapour Pressur |
0.0493mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
