ChemNet > CAS > 78985-13-4 2,3,5,6-Tetramethylbenzyl alcohol
78985-13-4 2,3,5,6-Tetramethylbenzyl alcohol
| product Name |
2,3,5,6-Tetramethylbenzyl alcohol |
| CAS No |
78985-13-4 |
| Synonyms |
(2,3,5,6-tetramethylphenyl)methanol |
| Molecular Formula |
C11H16O |
| Molecular Weight |
164.2441 |
| InChI |
InChI=1/C11H16O/c1-7-5-8(2)10(4)11(6-12)9(7)3/h5,12H,6H2,1-4H3 |
| Molecular Structure |
|
| Density |
0.975g/cm3 |
| Boiling point |
245.2°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
110.7°C |
| Vapour Pressur |
0.0155mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
