ChemNet > CAS > 80166-90-1 5-Bromo-7-nitroindoline
80166-90-1 5-Bromo-7-nitroindoline
| product Name |
5-Bromo-7-nitroindoline |
| CAS No |
80166-90-1 |
| Synonyms |
5-Bromo-7-Nitro-2,3-dihydro-1H-indole |
| Molecular Formula |
C8H7BrN2O2 |
| Molecular Weight |
243.0574 |
| InChI |
InChI=1/C8H7BrN2O2/c9-6-3-5-1-2-10-8(5)7(4-6)11(12)13/h3-4,10H,1-2H2 |
| EINECS |
279-411-4 |
| Molecular Structure |
|
| Density |
1.704g/cm3 |
| Boiling point |
344.2°C at 760 mmHg |
| Refractive index |
1.64 |
| Flash point |
162°C |
| Vapour Pressur |
6.67E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
