CAS No: 80286-58-4, Chemical Name: 2-[(4R)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid
the physical and chemical property of 80286-58-4, 2-[(4R)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid is provided by ChemNet.com
ChemNet > CAS > 80286-58-4 2-[(4R)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid
80286-58-4 2-[(4R)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid
product Name |
2-[(4R)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid |
Synonyms |
Artemisic Acid; Artemisinic acid |
Molecular Formula |
C15H22O2 |
Molecular Weight |
234.334 |
InChI |
InChI=1/C15H22O2/c1-9-4-6-12-10(2)5-7-13(14(12)8-9)11(3)15(16)17/h8,10,12-14H,3-7H2,1-2H3,(H,16,17)/t10-,12?,13?,14?/m1/s1 |
CAS Registry Number |
80286-58-4 |
Molecular Structure |
|
Density |
1.019g/cm3 |
Boiling point |
373.6°C at 760 mmHg |
Refractive index |
1.504 |
Flash point |
273.3°C |
Vapour Pressur |
1.31E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
|
|