ChemNet > CAS > 80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
| product Name |
4-Methyl-3-nitrobenzeneboronic acid |
| CAS No |
80500-27-2 |
| Synonyms |
4-Methyl-3-nitrophenylboronic acid; 3-Nitro-p-tolylboronic acid; (4-methyl-3-nitrophenyl)boronic acid; 4-methyl-3-nitrophenylboronic acid; 3-Nitropheny-4-methylphenylboronic acid |
| Molecular Formula |
C7H8BNO4 |
| Molecular Weight |
180.9537 |
| InChI |
InChI=1/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Melting point |
265-270 °C(lit.) |
| Boiling point |
356.7°C at 760 mmHg |
| Refractive index |
1.563 |
| Flash point |
169.5°C |
| Vapour Pressur |
1.05E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
