ChemNet > CAS > 80657-64-3 A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate
80657-64-3 A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate
| product Name |
A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate |
| CAS No |
80657-64-3 |
| Synonyms |
4,7-Methano-3aH-indene-3a-carboxylic acid, octahydro-, ethyl ester, (3aalpha,4alpha,7alpha,7aalpha)-; Ethyl hexahydro-4,7-methanoindane-3a-carboxylate; ethyl (3aR,4S,7R,7aR)-octahydro-3aH-4,7-methanoindene-3a-carboxylate |
| Molecular Formula |
C13H20O2 |
| Molecular Weight |
208.2967 |
| InChI |
InChI=1/C13H20O2/c1-2-15-12(14)13-7-3-4-11(13)9-5-6-10(13)8-9/h9-11H,2-8H2,1H3/t9-,10+,11-,13-/m1/s1 |
| EINECS |
407-520-0 |
| Molecular Structure |
![80657-64-3 A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate](https://images-a.chemnet.com/suppliers/chembase/cas6/cas80657-64-3.gif)
|
| Density |
1.106g/cm3 |
| Boiling point |
261.8°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
109.9°C |
| Vapour Pressur |
0.0113mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
