ChemNet > CAS > 80866-75-7 3-Methyl-4-nitrobenzyl alcohol
80866-75-7 3-Methyl-4-nitrobenzyl alcohol
| product Name |
3-Methyl-4-nitrobenzyl alcohol |
| CAS No |
80866-75-7 |
| Synonyms |
(3-methyl-4-nitrophenyl)methanol |
| Molecular Formula |
C8H9NO3 |
| Molecular Weight |
167.162 |
| InChI |
InChI=1/C8H9NO3/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4,10H,5H2,1H3 |
| EINECS |
279-578-3 |
| Molecular Structure |
|
| Density |
1.272g/cm3 |
| Melting point |
56-60℃ |
| Boiling point |
322.6°C at 760 mmHg |
| Refractive index |
1.585 |
| Flash point |
145.2°C |
| Vapour Pressur |
0.000114mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
