ChemNet > CAS > 80866-80-4 2-Chloro-5-nitrobenzyl alcohol
80866-80-4 2-Chloro-5-nitrobenzyl alcohol
| product Name |
2-Chloro-5-nitrobenzyl alcohol |
| CAS No |
80866-80-4 |
| Synonyms |
(2-chloro-5-nitrophenyl)methanol |
| Molecular Formula |
C7H6ClNO3 |
| Molecular Weight |
187.5804 |
| InChI |
InChI=1/C7H6ClNO3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-3,10H,4H2 |
| EINECS |
279-584-6 |
| Molecular Structure |
|
| Density |
1.476g/cm3 |
| Melting point |
74-79℃ |
| Boiling point |
344.1°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
161.9°C |
| Vapour Pressur |
2.56E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
