ChemNet > CAS > 80866-82-6 5-Bromo-2-methoxybenzyl alcohol
80866-82-6 5-Bromo-2-methoxybenzyl alcohol
| product Name |
5-Bromo-2-methoxybenzyl alcohol |
| CAS No |
80866-82-6 |
| Synonyms |
5-Bromo-o-anisyl alcohol; (5-bromo-2-methoxyphenyl)methanol; 5-Bromo-2-methoxybenzylalcohol |
| Molecular Formula |
C8H9BrO2 |
| Molecular Weight |
217.0599 |
| InChI |
InChI=1/C8H9BrO2/c1-11-8-3-2-7(9)4-6(8)5-10/h2-4,10H,5H2,1H3 |
| EINECS |
279-586-7 |
| Molecular Structure |
|
| Density |
1.513g/cm3 |
| Melting point |
68-71℃ |
| Boiling point |
299.4°C at 760 mmHg |
| Refractive index |
1.57 |
| Flash point |
134.9°C |
| Vapour Pressur |
0.000533mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
