ChemNet > CAS > 80866-83-7 2-Phenylpropyl butyrate
80866-83-7 2-Phenylpropyl butyrate
| product Name |
2-Phenylpropyl butyrate |
| CAS No |
80866-83-7 |
| Synonyms |
Butanoic acid, 2-phenylpropyl ester; FEMA No. 2891; Hydratropyl butyrate; Methylphenethyl butyrate, beta-; 2-phenylpropyl butanoate; (2S)-2-phenylpropyl butanoate; (2R)-2-phenylpropyl butanoate; 2-Phenyl-1-propyl butyrate |
| Molecular Formula |
C13H18O2 |
| Molecular Weight |
206.2808 |
| InChI |
InChI=1/C13H18O2/c1-3-7-13(14)15-10-11(2)12-8-5-4-6-9-12/h4-6,8-9,11H,3,7,10H2,1-2H3/t11-/m0/s1 |
| EINECS |
279-587-2 |
| Molecular Structure |
|
| Density |
0.986g/cm3 |
| Boiling point |
276.8°C at 760 mmHg |
| Refractive index |
1.493 |
| Flash point |
104.6°C |
| Vapour Pressur |
0.00469mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
