ChemNet > CAS > 81029-03-0 2,3-Dimethyl-p-nitroanisole
81029-03-0 2,3-Dimethyl-p-nitroanisole
| product Name |
2,3-Dimethyl-p-nitroanisole |
| CAS No |
81029-03-0 |
| Synonyms |
2,3-Dimethyl-4-nitroanisole; 1-methoxy-2,3-dimethyl-4-nitrobenzene |
| Molecular Formula |
C9H11NO3 |
| Molecular Weight |
181.1885 |
| InChI |
InChI=1/C9H11NO3/c1-6-7(2)9(13-3)5-4-8(6)10(11)12/h4-5H,1-3H3 |
| EINECS |
279-674-5 |
| Molecular Structure |
|
| Density |
1.148g/cm3 |
| Melting point |
70-73℃ |
| Boiling point |
303.2°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
141.2°C |
| Vapour Pressur |
0.0017mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
