ChemNet > CAS > 81067-38-1 1-Bromo-2,3,5-trichlorobenzene
81067-38-1 1-Bromo-2,3,5-trichlorobenzene
| product Name |
1-Bromo-2,3,5-trichlorobenzene |
| CAS No |
81067-38-1 |
| Synonyms |
2,3,5-Trichlorobromobenzene |
| Molecular Formula |
C6H2BrCl3 |
| Molecular Weight |
260.3431 |
| InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
| Molecular Structure |
|
| Density |
1.84g/cm3 |
| Melting point |
58-61℃ |
| Boiling point |
270.8°C at 760 mmHg |
| Refractive index |
1.603 |
| Flash point |
129.3°C |
| Vapour Pressur |
0.0111mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
