ChemNet > CAS > 81156-68-5 2,4-Dichlorophenethylalcohol
81156-68-5 2,4-Dichlorophenethylalcohol
| product Name |
2,4-Dichlorophenethylalcohol |
| CAS No |
81156-68-5 |
| Synonyms |
2-(2,4-Dichlorophenyl)-ethanol; 2,4-dichlorophenethyl alcohol; 2-(2,4-Dichlorophenyl)ethanol |
| Molecular Formula |
C8H8Cl2O |
| Molecular Weight |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5,11H,3-4H2 |
| Molecular Structure |
|
| Density |
1.329g/cm3 |
| Boiling point |
276.6°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
117.2°C |
| Vapour Pressur |
0.00229mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
