ChemNet > CAS > 81321-10-0 methyl 3-isothiocyanatothiophene-2-carboxylate
81321-10-0 methyl 3-isothiocyanatothiophene-2-carboxylate
| product Name |
methyl 3-isothiocyanatothiophene-2-carboxylate |
| CAS No |
81321-10-0 |
| Molecular Formula |
C7H5NO2S2 |
| Molecular Weight |
199.2501 |
| InChI |
InChI=1/C7H5NO2S2/c1-10-7(9)6-5(8-4-11)2-3-12-6/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.35g/cm3 |
| Melting point |
56℃ |
| Boiling point |
340.3°C at 760 mmHg |
| Refractive index |
1.63 |
| Flash point |
159.6°C |
| Vapour Pressur |
8.7E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
