ChemNet > CAS > 81452-54-2 Methyl 3-methylthiophene-2-carboxylate
81452-54-2 Methyl 3-methylthiophene-2-carboxylate
| product Name |
Methyl 3-methylthiophene-2-carboxylate |
| CAS No |
81452-54-2 |
| Synonyms |
3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
| Molecular Formula |
C7H8O2S |
| Molecular Weight |
156.2022 |
| InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
| Molecular Structure |
|
| Density |
1.173g/cm3 |
| Boiling point |
211°C at 760 mmHg |
| Refractive index |
1.531 |
| Flash point |
81.4°C |
| Vapour Pressur |
0.186mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
